About 6-methoxy-3-phenyl-5,6-dihydronaphthalen-1-ol
6-methoxy-3-phenyl-5,6-dihydronaphthalen-1-ol (PubChem CID 163990519) has the molecular formula C17H16O2
and a molecular weight of 252.31 g/mol. Its IUPAC name is 6-methoxy-3-phenyl-5,6-dihydronaphthalen-1-ol.
Molecular Properties
| Compound Name | 6-methoxy-3-phenyl-5,6-dihydronaphthalen-1-ol |
| PubChem CID | 163990519 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 6-methoxy-3-phenyl-5,6-dihydronaphthalen-1-ol |
| SMILES | COC1C=Cc2c(O)cc(-c3ccccc3)cc2C1 |
| InChI | InChI=1S/C17H16O2/c1-19-15-7-8-16-14(10-15)9-13(11-17(16)18)12-5-3-2-4-6-12/h2-9,11,15,18H,10H2,1H3 |
| InChIKey | UAFIXVKQAFBJTI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methoxy-3-phenyl-5,6-dihydronaphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-3-phenyl-5,6-dihydronaphthalen-1-ol?
The IUPAC name of 6-methoxy-3-phenyl-5,6-dihydronaphthalen-1-ol (CID 163990519) is 6-methoxy-3-phenyl-5,6-dihydronaphthalen-1-ol.
What is the SMILES notation for 6-methoxy-3-phenyl-5,6-dihydronaphthalen-1-ol?
The canonical SMILES for 6-methoxy-3-phenyl-5,6-dihydronaphthalen-1-ol is COC1C=Cc2c(O)cc(-c3ccccc3)cc2C1.
What is the InChIKey of 6-methoxy-3-phenyl-5,6-dihydronaphthalen-1-ol?
The InChIKey is UAFIXVKQAFBJTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O2/c1-19-15-7-8-16-14(10-15)9-13(11-17(16)18)12-5-3-2-4-6-12/h2-9,11,15,18H,10H2,1H3.
What are the key properties of 6-methoxy-3-phenyl-5,6-dihydronaphthalen-1-ol?
6-methoxy-3-phenyl-5,6-dihydronaphthalen-1-ol has a molecular weight of 252.31 g/mol, XLogP of 3.64, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-3-phenyl-5,6-dihydronaphthalen-1-ol is sourced from PubChem (CID 163990519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).