C25H30F2INO3 — CID 163990838
2-[[(2R,5S,6S)-6-[5-[difluoro(iodo)methyl]-2-methylphenyl]-5-[(1R)-1-phenylpropyl]oxan-2-yl]methylamino]acetic acid (PubChem CID 163990838) has the molecular formula C25H30F2INO3 and a molecular weight of 557.42 g/mol. Its IUPAC name is 2-[[(2R,5S,6S)-6-[5-[difluoro(iodo)methyl]-2-methylphenyl]-5-[(1R)-1-phenylpropyl]oxan-2-yl]methylamino]acetic acid.
| Compound Name | 2-[[(2R,5S,6S)-6-[5-[difluoro(iodo)methyl]-2-methylphenyl]-5-[(1R)-1-phenylpropyl]oxan-2-yl]methylamino]acetic acid |
|---|---|
| PubChem CID | 163990838 |
| Molecular Formula | C25H30F2INO3 |
| Molecular Weight | 557.42 g/mol |
| Exact Mass | 557.12 |
| IUPAC Name | 2-[[(2R,5S,6S)-6-[5-[difluoro(iodo)methyl]-2-methylphenyl]-5-[(1R)-1-phenylpropyl]oxan-2-yl]methylamino]acetic acid |
| SMILES | CC[C@@H](c1ccccc1)[C@@H]1CC[C@H](CNCC(=O)O)O[C@@H]1c1cc(C(F)(F)I)ccc1C |
| InChI | InChI=1S/C25H30F2INO3/c1-3-20(17-7-5-4-6-8-17)21-12-11-19(14-29-15-23(30)31)32-24(21)22-13-18(25(26,27)28)10-9-16(22)2/h4-10,13,19-21,24,29H,3,11-12,14-15H2,1-2H3,(H,30,31)/t19-,20+,21+,24+/m1/s1 |
| InChIKey | UAMNUDFTXSBQBS-XBJMDHIQSA-N |
| XLogP | 6.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.42 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|