C13H21N3O3S — CID 163991287
4-[[(Z)-1,3-diamino-2-methylbut-1-enyl]amino]-1-methylcyclohepta-2,4,6-triene-1-sulfonic acid (PubChem CID 163991287) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 4-[[(Z)-1,3-diamino-2-methylbut-1-enyl]amino]-1-methylcyclohepta-2,4,6-triene-1-sulfonic acid.
| Compound Name | 4-[[(Z)-1,3-diamino-2-methylbut-1-enyl]amino]-1-methylcyclohepta-2,4,6-triene-1-sulfonic acid |
|---|---|
| PubChem CID | 163991287 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 4-[[(Z)-1,3-diamino-2-methylbut-1-enyl]amino]-1-methylcyclohepta-2,4,6-triene-1-sulfonic acid |
| SMILES | C/C(=C(\N)NC1=CC=CC(C)(S(=O)(=O)O)C=C1)C(C)N |
| InChI | InChI=1S/C13H21N3O3S/c1-9(10(2)14)12(15)16-11-5-4-7-13(3,8-6-11)20(17,18)19/h4-8,10,16H,14-15H2,1-3H3,(H,17,18,19)/b12-9- |
| InChIKey | UAVFEXSWBQAIDC-XFXZXTDPSA-N |
| XLogP | 0.77 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|