C17H18N4O — CID 163991353
(3Z,5E)-2-methylidene-1-(pyridazin-4-ylamino)-6-pyridin-4-ylhepta-3,5-dien-1-ol (PubChem CID 163991353) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is (3Z,5E)-2-methylidene-1-(pyridazin-4-ylamino)-6-pyridin-4-ylhepta-3,5-dien-1-ol.
| Compound Name | (3Z,5E)-2-methylidene-1-(pyridazin-4-ylamino)-6-pyridin-4-ylhepta-3,5-dien-1-ol |
|---|---|
| PubChem CID | 163991353 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (3Z,5E)-2-methylidene-1-(pyridazin-4-ylamino)-6-pyridin-4-ylhepta-3,5-dien-1-ol |
| SMILES | C=C(/C=C\C=C(/C)c1ccncc1)C(O)Nc1ccnnc1 |
| InChI | InChI=1S/C17H18N4O/c1-13(15-6-9-18-10-7-15)4-3-5-14(2)17(22)21-16-8-11-19-20-12-16/h3-12,17,22H,2H2,1H3,(H,19,21)/b5-3-,13-4+ |
| InChIKey | UAWPTYOSQSPPDY-OHOMROLUSA-N |
| XLogP | 2.82 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|