C25H44O16 — CID 163991369
(Z)-1-[3-methyl-2-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxycyclohexyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhex-2-ene-1,2,4,6-tetrol (PubChem CID 163991369) has the molecular formula C25H44O16 and a molecular weight of 600.61 g/mol. Its IUPAC name is (Z)-1-[3-methyl-2-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxycyclohexyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhex-2-ene-1,2,4,6-tetrol.
| Compound Name | (Z)-1-[3-methyl-2-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxycyclohexyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhex-2-ene-1,2,4,6-tetrol |
|---|---|
| PubChem CID | 163991369 |
| Molecular Formula | C25H44O16 |
| Molecular Weight | 600.61 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | (Z)-1-[3-methyl-2-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxycyclohexyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhex-2-ene-1,2,4,6-tetrol |
| SMILES | CC1CCCC(OC(O)/C(O)=C(/OC2OC(CO)C(O)C(O)C2O)C(O)CCO)C1OC1OC(C)C(O)C(O)C1O |
| InChI | InChI=1S/C25H44O16/c1-9-4-3-5-12(21(9)40-24-18(33)16(31)14(29)10(2)37-24)38-23(36)20(35)22(11(28)6-7-26)41-25-19(34)17(32)15(30)13(8-27)39-25/h9-19,21,23-36H,3-8H2,1-2H3/b22-20- |
| InChIKey | UAWZRSODRVRTIR-XDOYNYLZSA-N |
| XLogP | -3.95 |
| TPSA | 268.68 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.61 |
| LogP ≤ 5 | -3.95 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|