C28H37N3O4 — CID 163991529
(1R,2S,5S)-N-[(1S)-1-cyano-2-[(1S)-4,4-dimethyl-2-oxocyclohexyl]ethyl]-6,6-dimethyl-3-[2-(4-methylphenoxy)acetyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 163991529) has the molecular formula C28H37N3O4 and a molecular weight of 479.62 g/mol. Its IUPAC name is (1R,2S,5S)-N-[(1S)-1-cyano-2-[(1S)-4,4-dimethyl-2-oxocyclohexyl]ethyl]-6,6-dimethyl-3-[2-(4-methylphenoxy)acetyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-[(1S)-1-cyano-2-[(1S)-4,4-dimethyl-2-oxocyclohexyl]ethyl]-6,6-dimethyl-3-[2-(4-methylphenoxy)acetyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 163991529 |
| Molecular Formula | C28H37N3O4 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | (1R,2S,5S)-N-[(1S)-1-cyano-2-[(1S)-4,4-dimethyl-2-oxocyclohexyl]ethyl]-6,6-dimethyl-3-[2-(4-methylphenoxy)acetyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | Cc1ccc(OCC(=O)N2C[C@H]3[C@@H]([C@H]2C(=O)N[C@H](C#N)C[C@@H]2CCC(C)(C)CC2=O)C3(C)C)cc1 |
| InChI | InChI=1S/C28H37N3O4/c1-17-6-8-20(9-7-17)35-16-23(33)31-15-21-24(28(21,4)5)25(31)26(34)30-19(14-29)12-18-10-11-27(2,3)13-22(18)32/h6-9,18-19,21,24-25H,10-13,15-16H2,1-5H3,(H,30,34)/t18-,19-,21-,24-,25-/m0/s1 |
| InChIKey | UBASCCBOBVRLPT-BFUNFQTRSA-N |
| XLogP | 3.65 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |