C16H21BrN2O3 — CID 163992923
(3S)-7-bromo-3-[[3-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]amino]-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 163992923) has the molecular formula C16H21BrN2O3 and a molecular weight of 369.26 g/mol. Its IUPAC name is (3S)-7-bromo-3-[[3-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]amino]-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | (3S)-7-bromo-3-[[3-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]amino]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 163992923 |
| Molecular Formula | C16H21BrN2O3 |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | (3S)-7-bromo-3-[[3-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]amino]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | CC(C)(C)OC1OC1N[C@H]1CCc2cc(Br)ccc2NC1=O |
| InChI | InChI=1S/C16H21BrN2O3/c1-16(2,3)22-15-14(21-15)19-12-6-4-9-8-10(17)5-7-11(9)18-13(12)20/h5,7-8,12,14-15,19H,4,6H2,1-3H3,(H,18,20)/t12-,14?,15?/m0/s1 |
| InChIKey | UCFUGKDWRXFUIU-GRTSSRMGSA-N |
| XLogP | 2.79 |
| TPSA | 62.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|