C16H25NO2 — CID 163993203
N-[2-[(3R,5S)-5-formyl-2,3-dimethylcycloocta-1,7-dien-1-yl]ethyl]-N-methylacetamide (PubChem CID 163993203) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is N-[2-[(3R,5S)-5-formyl-2,3-dimethylcycloocta-1,7-dien-1-yl]ethyl]-N-methylacetamide.
| Compound Name | N-[2-[(3R,5S)-5-formyl-2,3-dimethylcycloocta-1,7-dien-1-yl]ethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 163993203 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | N-[2-[(3R,5S)-5-formyl-2,3-dimethylcycloocta-1,7-dien-1-yl]ethyl]-N-methylacetamide |
| SMILES | CC(=O)N(C)CCC1=C(C)[C@H](C)C[C@@H](C=O)CC=C1 |
| InChI | InChI=1S/C16H25NO2/c1-12-10-15(11-18)6-5-7-16(13(12)2)8-9-17(4)14(3)19/h5,7,11-12,15H,6,8-10H2,1-4H3/t12-,15+/m1/s1 |
| InChIKey | UCLGPHWFGHONJJ-DOMZBBRYSA-N |
| XLogP | 2.97 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|