About 2-benzyl-1,2,4-triazol-3-amine;hydrochloride
2-benzyl-1,2,4-triazol-3-amine;hydrochloride (PubChem CID 163993287) has the molecular formula C9H11ClN4
and a molecular weight of 210.67 g/mol. Its IUPAC name is 2-benzyl-1,2,4-triazol-3-amine;hydrochloride.
Molecular Properties
| Compound Name | 2-benzyl-1,2,4-triazol-3-amine;hydrochloride |
| PubChem CID | 163993287 |
| Molecular Formula | C9H11ClN4 |
| Molecular Weight | 210.67 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 2-benzyl-1,2,4-triazol-3-amine;hydrochloride |
| SMILES | Cl.Nc1ncnn1Cc1ccccc1 |
| InChI | InChI=1S/C9H10N4.ClH/c10-9-11-7-12-13(9)6-8-4-2-1-3-5-8;/h1-5,7H,6H2,(H2,10,11,12);1H |
| InChIKey | UCMYDRJUMZZLNS-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.67 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-benzyl-1,2,4-triazol-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1,2,4-triazol-3-amine;hydrochloride?
The IUPAC name of 2-benzyl-1,2,4-triazol-3-amine;hydrochloride (CID 163993287) is 2-benzyl-1,2,4-triazol-3-amine;hydrochloride.
What is the SMILES notation for 2-benzyl-1,2,4-triazol-3-amine;hydrochloride?
The canonical SMILES for 2-benzyl-1,2,4-triazol-3-amine;hydrochloride is Cl.Nc1ncnn1Cc1ccccc1.
What is the InChIKey of 2-benzyl-1,2,4-triazol-3-amine;hydrochloride?
The InChIKey is UCMYDRJUMZZLNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4.ClH/c10-9-11-7-12-13(9)6-8-4-2-1-3-5-8;/h1-5,7H,6H2,(H2,10,11,12);1H.
What are the key properties of 2-benzyl-1,2,4-triazol-3-amine;hydrochloride?
2-benzyl-1,2,4-triazol-3-amine;hydrochloride has a molecular weight of 210.67 g/mol, XLogP of 1.33, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1,2,4-triazol-3-amine;hydrochloride is sourced from PubChem (CID 163993287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).