About CID 163993340
CID 163993340 (PubChem CID 163993340) has the molecular formula C10H18BFOSi
and a molecular weight of 212.15 g/mol.
Molecular Properties
| Compound Name | CID 163993340 |
| PubChem CID | 163993340 |
| Molecular Formula | C10H18BFOSi |
| Molecular Weight | 212.15 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | — |
| SMILES | [B]C1CC=C([Si](C)(C)C)C(F)C1CO |
| InChI | InChI=1S/C10H18BFOSi/c1-14(2,3)9-5-4-8(11)7(6-13)10(9)12/h5,7-8,10,13H,4,6H2,1-3H3 |
| InChIKey | IUESHLTWNCTOSW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.15 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 163993340 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163993340?
The IUPAC name of CID 163993340 (CID 163993340) is not available.
What is the SMILES notation for CID 163993340?
The canonical SMILES for CID 163993340 is [B]C1CC=C([Si](C)(C)C)C(F)C1CO.
What is the InChIKey of CID 163993340?
The InChIKey is IUESHLTWNCTOSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18BFOSi/c1-14(2,3)9-5-4-8(11)7(6-13)10(9)12/h5,7-8,10,13H,4,6H2,1-3H3.
What are the key properties of CID 163993340?
CID 163993340 has a molecular weight of 212.15 g/mol, XLogP of 2.10, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163993340 is sourced from PubChem (CID 163993340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).