C5H3Cl2F5 — CID 163994152
2,3-dichloro-4,4,5,5,5-pentafluoropent-2-ene (PubChem CID 163994152) has the molecular formula C5H3Cl2F5 and a molecular weight of 228.97 g/mol. Its IUPAC name is 2,3-dichloro-4,4,5,5,5-pentafluoropent-2-ene.
| Compound Name | 2,3-dichloro-4,4,5,5,5-pentafluoropent-2-ene |
|---|---|
| PubChem CID | 163994152 |
| Molecular Formula | C5H3Cl2F5 |
| Molecular Weight | 228.97 g/mol |
| Exact Mass | 227.95 |
| IUPAC Name | 2,3-dichloro-4,4,5,5,5-pentafluoropent-2-ene |
| SMILES | CC(Cl)=C(Cl)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H3Cl2F5/c1-2(6)3(7)4(8,9)5(10,11)12/h1H3 |
| InChIKey | UELOGUBGUJHGPJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.97 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|