About (4R)-4-propan-2-yl-3,4-dihydropyridine
(4R)-4-propan-2-yl-3,4-dihydropyridine (PubChem CID 163994687) has the molecular formula C8H13N
and a molecular weight of 123.20 g/mol. Its IUPAC name is (4R)-4-propan-2-yl-3,4-dihydropyridine.
Molecular Properties
| Compound Name | (4R)-4-propan-2-yl-3,4-dihydropyridine |
| PubChem CID | 163994687 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | (4R)-4-propan-2-yl-3,4-dihydropyridine |
| SMILES | CC(C)[C@@H]1C=CN=CC1 |
| InChI | InChI=1S/C8H13N/c1-7(2)8-3-5-9-6-4-8/h3,5-8H,4H2,1-2H3/t8-/m1/s1 |
| InChIKey | UDQQQVANEVVRMT-MRVPVSSYSA-N |
| XLogP | 2.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4R)-4-propan-2-yl-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-propan-2-yl-3,4-dihydropyridine?
The IUPAC name of (4R)-4-propan-2-yl-3,4-dihydropyridine (CID 163994687) is (4R)-4-propan-2-yl-3,4-dihydropyridine.
What is the SMILES notation for (4R)-4-propan-2-yl-3,4-dihydropyridine?
The canonical SMILES for (4R)-4-propan-2-yl-3,4-dihydropyridine is CC(C)[C@@H]1C=CN=CC1.
What is the InChIKey of (4R)-4-propan-2-yl-3,4-dihydropyridine?
The InChIKey is UDQQQVANEVVRMT-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H13N/c1-7(2)8-3-5-9-6-4-8/h3,5-8H,4H2,1-2H3/t8-/m1/s1.
What are the key properties of (4R)-4-propan-2-yl-3,4-dihydropyridine?
(4R)-4-propan-2-yl-3,4-dihydropyridine has a molecular weight of 123.20 g/mol, XLogP of 2.25, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-propan-2-yl-3,4-dihydropyridine is sourced from PubChem (CID 163994687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).