C15H17N5 — CID 163995023
12-[(3R,4S)-4-ethenylpiperidin-3-yl]-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 163995023) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is 12-[(3R,4S)-4-ethenylpiperidin-3-yl]-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 12-[(3R,4S)-4-ethenylpiperidin-3-yl]-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 163995023 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 12-[(3R,4S)-4-ethenylpiperidin-3-yl]-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | C=C[C@@H]1CCNC[C@@H]1c1ncc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C15H17N5/c1-2-10-3-5-16-9-12(10)15-19-8-11-7-18-14-13(20(11)15)4-6-17-14/h2,4,6-8,10,12,16-17H,1,3,5,9H2/t10-,12+/m1/s1 |
| InChIKey | UDXZVMVHKZLMSJ-PWSUYJOCSA-N |
| XLogP | 2.09 |
| TPSA | 58.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|