C32H36FN6O7P — CID 163995171
ethyl (2S)-2-[[[(2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3-hydroxy-4,5-dimethyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-(1H-indol-3-yl)propanoate (PubChem CID 163995171) has the molecular formula C32H36FN6O7P and a molecular weight of 666.65 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3-hydroxy-4,5-dimethyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3-hydroxy-4,5-dimethyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 163995171 |
| Molecular Formula | C32H36FN6O7P |
| Molecular Weight | 666.65 g/mol |
| Exact Mass | 666.24 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3-hydroxy-4,5-dimethyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-(1H-indol-3-yl)propanoate |
| SMILES | CCOC(=O)[C@H](Cc1c[nH]c2ccccc12)NP(=O)(OC[C@H]1O[C@@](C)(c2ccc3c(N)ncnn23)[C@](C)(F)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C32H36FN6O7P/c1-4-43-30(41)24(16-20-17-35-23-13-9-8-12-22(20)23)38-47(42,46-21-10-6-5-7-11-21)44-18-26-28(40)31(2,33)32(3,45-26)27-15-14-25-29(34)36-19-37-39(25)27/h5-15,17,19,24,26,28,35,40H,4,16,18H2,1-3H3,(H,38,42)(H2,34,36,37)/t24-,26+,28+,31+,32-,47?/m0/s1 |
| InChIKey | UEBBHAGMQRJOLZ-ALCRVGFDSA-N |
| XLogP | 4.46 |
| TPSA | 175.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.65 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|