About 3-ethyltricyclo[4.3.1.12,5]undecane
3-ethyltricyclo[4.3.1.12,5]undecane (PubChem CID 163995336) has the molecular formula C13H22
and a molecular weight of 178.32 g/mol. Its IUPAC name is 3-ethyltricyclo[4.3.1.12,5]undecane.
Molecular Properties
| Compound Name | 3-ethyltricyclo[4.3.1.12,5]undecane |
| PubChem CID | 163995336 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | 3-ethyltricyclo[4.3.1.12,5]undecane |
| SMILES | CCC1CC2CC1C1CCCC2C1 |
| InChI | InChI=1S/C13H22/c1-2-9-6-12-8-13(9)11-5-3-4-10(12)7-11/h9-13H,2-8H2,1H3 |
| InChIKey | UEEQTJVAKPNGPL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-ethyltricyclo[4.3.1.12,5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyltricyclo[4.3.1.12,5]undecane?
The IUPAC name of 3-ethyltricyclo[4.3.1.12,5]undecane (CID 163995336) is 3-ethyltricyclo[4.3.1.12,5]undecane.
What is the SMILES notation for 3-ethyltricyclo[4.3.1.12,5]undecane?
The canonical SMILES for 3-ethyltricyclo[4.3.1.12,5]undecane is CCC1CC2CC1C1CCCC2C1.
What is the InChIKey of 3-ethyltricyclo[4.3.1.12,5]undecane?
The InChIKey is UEEQTJVAKPNGPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22/c1-2-9-6-12-8-13(9)11-5-3-4-10(12)7-11/h9-13H,2-8H2,1H3.
What are the key properties of 3-ethyltricyclo[4.3.1.12,5]undecane?
3-ethyltricyclo[4.3.1.12,5]undecane has a molecular weight of 178.32 g/mol, XLogP of 3.86, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyltricyclo[4.3.1.12,5]undecane is sourced from PubChem (CID 163995336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).