C33H38N4S — CID 163995483
2-[2-[4-(2,3,5a,6a,10a,10b-hexahydrothieno[3,2-c]carbazol-6-yl)cyclohexa-1,3-dien-1-yl]-6-(2,3-dihydro-1H-pyrrol-4-yl)-3,4-dihydropyridin-4-yl]butan-1-imine (PubChem CID 163995483) has the molecular formula C33H38N4S and a molecular weight of 522.76 g/mol. Its IUPAC name is 2-[2-[4-(2,3,5a,6a,10a,10b-hexahydrothieno[3,2-c]carbazol-6-yl)cyclohexa-1,3-dien-1-yl]-6-(2,3-dihydro-1H-pyrrol-4-yl)-3,4-dihydropyridin-4-yl]butan-1-imine.
| Compound Name | 2-[2-[4-(2,3,5a,6a,10a,10b-hexahydrothieno[3,2-c]carbazol-6-yl)cyclohexa-1,3-dien-1-yl]-6-(2,3-dihydro-1H-pyrrol-4-yl)-3,4-dihydropyridin-4-yl]butan-1-imine |
|---|---|
| PubChem CID | 163995483 |
| Molecular Formula | C33H38N4S |
| Molecular Weight | 522.76 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | 2-[2-[4-(2,3,5a,6a,10a,10b-hexahydrothieno[3,2-c]carbazol-6-yl)cyclohexa-1,3-dien-1-yl]-6-(2,3-dihydro-1H-pyrrol-4-yl)-3,4-dihydropyridin-4-yl]butan-1-imine |
| SMILES | [H]/N=C/C(CC)C1C=C(C2=CNCC2)N=C(C2=CC=C(N3C4C=CC=CC4C4C5=C(C=CC43)CCS5)CC2)C1 |
| InChI | InChI=1S/C33H38N4S/c1-2-21(19-34)25-17-28(36-29(18-25)24-13-15-35-20-24)22-7-10-26(11-8-22)37-30-6-4-3-5-27(30)32-31(37)12-9-23-14-16-38-33(23)32/h3-7,9-10,12,18-21,25,27,30-32,34-35H,2,8,11,13-17H2,1H3/b34-19+ |
| InChIKey | UEHPLHKQZUKGNU-ALQBTCKLSA-N |
| XLogP | 6.86 |
| TPSA | 51.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.76 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|