C19H25NO2 — CID 163995750
(1R,15R,16S)-5-methoxy-15,16-dimethyl-11-azatetracyclo[9.6.0.01,14.02,7]heptadeca-2(7),3,5-trien-12-one (PubChem CID 163995750) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is (1R,15R,16S)-5-methoxy-15,16-dimethyl-11-azatetracyclo[9.6.0.01,14.02,7]heptadeca-2(7),3,5-trien-12-one.
| Compound Name | (1R,15R,16S)-5-methoxy-15,16-dimethyl-11-azatetracyclo[9.6.0.01,14.02,7]heptadeca-2(7),3,5-trien-12-one |
|---|---|
| PubChem CID | 163995750 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (1R,15R,16S)-5-methoxy-15,16-dimethyl-11-azatetracyclo[9.6.0.01,14.02,7]heptadeca-2(7),3,5-trien-12-one |
| SMILES | COc1ccc2c(c1)CCCN1C(=O)CC3[C@H](C)[C@@H](C)C[C@]231 |
| InChI | InChI=1S/C19H25NO2/c1-12-11-19-16-7-6-15(22-3)9-14(16)5-4-8-20(19)18(21)10-17(19)13(12)2/h6-7,9,12-13,17H,4-5,8,10-11H2,1-3H3/t12-,13+,17?,19-/m0/s1 |
| InChIKey | UEOAOGFNXJJJCJ-LWAFPMBPSA-N |
| XLogP | 3.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |