C11H15N3 — CID 163996097
1-(2-bicyclo[4.1.0]hept-4-enylmethyl)-5-methyl-1,2,4-triazole (PubChem CID 163996097) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 1-(2-bicyclo[4.1.0]hept-4-enylmethyl)-5-methyl-1,2,4-triazole.
| Compound Name | 1-(2-bicyclo[4.1.0]hept-4-enylmethyl)-5-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 163996097 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 1-(2-bicyclo[4.1.0]hept-4-enylmethyl)-5-methyl-1,2,4-triazole |
| SMILES | Cc1ncnn1CC1CC=CC2CC21 |
| InChI | InChI=1S/C11H15N3/c1-8-12-7-13-14(8)6-10-4-2-3-9-5-11(9)10/h2-3,7,9-11H,4-6H2,1H3 |
| InChIKey | UEUZRMSTQBWBBB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|