C16H29ClN6 — CID 163996118
3-[4-[2-[(2R)-3-chloro-2-methylbutyl]pyrrolidin-1-yl]piperidin-1-yl]-1H-1,2,4-triazol-5-amine (PubChem CID 163996118) has the molecular formula C16H29ClN6 and a molecular weight of 340.90 g/mol. Its IUPAC name is 3-[4-[2-[(2R)-3-chloro-2-methylbutyl]pyrrolidin-1-yl]piperidin-1-yl]-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-[4-[2-[(2R)-3-chloro-2-methylbutyl]pyrrolidin-1-yl]piperidin-1-yl]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 163996118 |
| Molecular Formula | C16H29ClN6 |
| Molecular Weight | 340.90 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | 3-[4-[2-[(2R)-3-chloro-2-methylbutyl]pyrrolidin-1-yl]piperidin-1-yl]-1H-1,2,4-triazol-5-amine |
| SMILES | CC(Cl)[C@H](C)CC1CCCN1C1CCN(c2n[nH]c(N)n2)CC1 |
| InChI | InChI=1S/C16H29ClN6/c1-11(12(2)17)10-14-4-3-7-23(14)13-5-8-22(9-6-13)16-19-15(18)20-21-16/h11-14H,3-10H2,1-2H3,(H3,18,19,20,21)/t11-,12?,14?/m1/s1 |
| InChIKey | UEVINWJULBKCDI-LKSINWNRSA-N |
| XLogP | 2.47 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.90 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|