C25H25N3O2S — CID 163997288
(4R)-6-[1-(cyclohexa-1,5-dien-1-ylmethylsulfinyl)indol-2-yl]-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one (PubChem CID 163997288) has the molecular formula C25H25N3O2S and a molecular weight of 431.56 g/mol. Its IUPAC name is (4R)-6-[1-(cyclohexa-1,5-dien-1-ylmethylsulfinyl)indol-2-yl]-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one.
| Compound Name | (4R)-6-[1-(cyclohexa-1,5-dien-1-ylmethylsulfinyl)indol-2-yl]-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 163997288 |
| Molecular Formula | C25H25N3O2S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | (4R)-6-[1-(cyclohexa-1,5-dien-1-ylmethylsulfinyl)indol-2-yl]-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
| SMILES | C[C@@H]1CC(=O)Nc2cccc(-c3cc4ccccc4n3S(=O)CC3=CCCC=C3)c2N1 |
| InChI | InChI=1S/C25H25N3O2S/c1-17-14-24(29)27-21-12-7-11-20(25(21)26-17)23-15-19-10-5-6-13-22(19)28(23)31(30)16-18-8-3-2-4-9-18/h3,5-13,15,17,26H,2,4,14,16H2,1H3,(H,27,29)/t17-,31?/m1/s1 |
| InChIKey | UFVHAAOUNYTJMP-WYXXSATOSA-N |
| XLogP | 5.24 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |