About 6-(4-chlorophenoxy)-2-(1,1-difluoroethyl)-N-methoxy-N-methylpyridine-3-carboxamide
6-(4-chlorophenoxy)-2-(1,1-difluoroethyl)-N-methoxy-N-methylpyridine-3-carboxamide (PubChem CID 163997314) has the molecular formula C16H15ClF2N2O3
and a molecular weight of 356.76 g/mol. Its IUPAC name is 6-(4-chlorophenoxy)-2-(1,1-difluoroethyl)-N-methoxy-N-methylpyridine-3-carboxamide.
Molecular Properties
| Compound Name | 6-(4-chlorophenoxy)-2-(1,1-difluoroethyl)-N-methoxy-N-methylpyridine-3-carboxamide |
| PubChem CID | 163997314 |
| Molecular Formula | C16H15ClF2N2O3 |
| Molecular Weight | 356.76 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 6-(4-chlorophenoxy)-2-(1,1-difluoroethyl)-N-methoxy-N-methylpyridine-3-carboxamide |
| SMILES | CON(C)C(=O)c1ccc(Oc2ccc(Cl)cc2)nc1C(C)(F)F |
| InChI | InChI=1S/C16H15ClF2N2O3/c1-16(18,19)14-12(15(22)21(2)23-3)8-9-13(20-14)24-11-6-4-10(17)5-7-11/h4-9H,1-3H3 |
| InChIKey | UFVRUYMWYLXNMC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.76 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-chlorophenoxy)-2-(1,1-difluoroethyl)-N-methoxy-N-methylpyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-chlorophenoxy)-2-(1,1-difluoroethyl)-N-methoxy-N-methylpyridine-3-carboxamide?
The IUPAC name of 6-(4-chlorophenoxy)-2-(1,1-difluoroethyl)-N-methoxy-N-methylpyridine-3-carboxamide (CID 163997314) is 6-(4-chlorophenoxy)-2-(1,1-difluoroethyl)-N-methoxy-N-methylpyridine-3-carboxamide.
What is the SMILES notation for 6-(4-chlorophenoxy)-2-(1,1-difluoroethyl)-N-methoxy-N-methylpyridine-3-carboxamide?
The canonical SMILES for 6-(4-chlorophenoxy)-2-(1,1-difluoroethyl)-N-methoxy-N-methylpyridine-3-carboxamide is CON(C)C(=O)c1ccc(Oc2ccc(Cl)cc2)nc1C(C)(F)F.
What is the InChIKey of 6-(4-chlorophenoxy)-2-(1,1-difluoroethyl)-N-methoxy-N-methylpyridine-3-carboxamide?
The InChIKey is UFVRUYMWYLXNMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClF2N2O3/c1-16(18,19)14-12(15(22)21(2)23-3)8-9-13(20-14)24-11-6-4-10(17)5-7-11/h4-9H,1-3H3.
What are the key properties of 6-(4-chlorophenoxy)-2-(1,1-difluoroethyl)-N-methoxy-N-methylpyridine-3-carboxamide?
6-(4-chlorophenoxy)-2-(1,1-difluoroethyl)-N-methoxy-N-methylpyridine-3-carboxamide has a molecular weight of 356.76 g/mol, XLogP of 4.27, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-chlorophenoxy)-2-(1,1-difluoroethyl)-N-methoxy-N-methylpyridine-3-carboxamide is sourced from PubChem (CID 163997314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).