C23H30O4 — CID 163997460
1-cyclohexa-1,5-dien-1-yloxy-4-[2-[1-(4-methylcyclohexa-1,3-dien-1-yl)oxyethoxy]ethoxy]cyclohexa-1,3-diene (PubChem CID 163997460) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yloxy-4-[2-[1-(4-methylcyclohexa-1,3-dien-1-yl)oxyethoxy]ethoxy]cyclohexa-1,3-diene.
| Compound Name | 1-cyclohexa-1,5-dien-1-yloxy-4-[2-[1-(4-methylcyclohexa-1,3-dien-1-yl)oxyethoxy]ethoxy]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 163997460 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yloxy-4-[2-[1-(4-methylcyclohexa-1,3-dien-1-yl)oxyethoxy]ethoxy]cyclohexa-1,3-diene |
| SMILES | CC1=CC=C(OC(C)OCCOC2=CC=C(OC3=CCCC=C3)CC2)CC1 |
| InChI | InChI=1S/C23H30O4/c1-18-8-10-22(11-9-18)26-19(2)24-16-17-25-20-12-14-23(15-13-20)27-21-6-4-3-5-7-21/h4,6-8,10,12,14,19H,3,5,9,11,13,15-17H2,1-2H3 |
| InChIKey | UFYXCMBYFUEUAL-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|