C22H15Cl3FN5O4 — CID 163998066
N-[2-[[2-[4-fluoro-7-[5-(trichloromethyl)-1,3,4-oxadiazol-2-yl]-1H-indol-3-yl]-2-oxoacetyl]amino]ethyl]benzamide (PubChem CID 163998066) has the molecular formula C22H15Cl3FN5O4 and a molecular weight of 538.75 g/mol. Its IUPAC name is N-[2-[[2-[4-fluoro-7-[5-(trichloromethyl)-1,3,4-oxadiazol-2-yl]-1H-indol-3-yl]-2-oxoacetyl]amino]ethyl]benzamide.
| Compound Name | N-[2-[[2-[4-fluoro-7-[5-(trichloromethyl)-1,3,4-oxadiazol-2-yl]-1H-indol-3-yl]-2-oxoacetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 163998066 |
| Molecular Formula | C22H15Cl3FN5O4 |
| Molecular Weight | 538.75 g/mol |
| Exact Mass | 537.02 |
| IUPAC Name | N-[2-[[2-[4-fluoro-7-[5-(trichloromethyl)-1,3,4-oxadiazol-2-yl]-1H-indol-3-yl]-2-oxoacetyl]amino]ethyl]benzamide |
| SMILES | O=C(NCCNC(=O)c1ccccc1)C(=O)c1c[nH]c2c(-c3nnc(C(Cl)(Cl)Cl)o3)ccc(F)c12 |
| InChI | InChI=1S/C22H15Cl3FN5O4/c23-22(24,25)21-31-30-20(35-21)12-6-7-14(26)15-13(10-29-16(12)15)17(32)19(34)28-9-8-27-18(33)11-4-2-1-3-5-11/h1-7,10,29H,8-9H2,(H,27,33)(H,28,34) |
| InChIKey | UGLQDWJALPVPHP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.75 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|