C11H18F2N+ — CID 163998090
4-(fluoromethyl)-5-[(Z)-3-fluoroprop-1-enyl]-1,1,3-trimethyl-2,3-dihydropyrrol-1-ium (PubChem CID 163998090) has the molecular formula C11H18F2N+ and a molecular weight of 202.27 g/mol. Its IUPAC name is 4-(fluoromethyl)-5-[(Z)-3-fluoroprop-1-enyl]-1,1,3-trimethyl-2,3-dihydropyrrol-1-ium.
| Compound Name | 4-(fluoromethyl)-5-[(Z)-3-fluoroprop-1-enyl]-1,1,3-trimethyl-2,3-dihydropyrrol-1-ium |
|---|---|
| PubChem CID | 163998090 |
| Molecular Formula | C11H18F2N+ |
| Molecular Weight | 202.27 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 4-(fluoromethyl)-5-[(Z)-3-fluoroprop-1-enyl]-1,1,3-trimethyl-2,3-dihydropyrrol-1-ium |
| SMILES | CC1C[N+](C)(C)C(/C=C\CF)=C1CF |
| InChI | InChI=1S/C11H18F2N/c1-9-8-14(2,3)11(5-4-6-12)10(9)7-13/h4-5,9H,6-8H2,1-3H3/q+1/b5-4- |
| InChIKey | FNHPYNRPXGWFCF-PLNGDYQASA-N |
| XLogP | 2.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|