About 4-propan-2-ylbenzene-1,2,3-triamine
4-propan-2-ylbenzene-1,2,3-triamine (PubChem CID 163998803) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is 4-propan-2-ylbenzene-1,2,3-triamine.
Molecular Properties
| Compound Name | 4-propan-2-ylbenzene-1,2,3-triamine |
| PubChem CID | 163998803 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 4-propan-2-ylbenzene-1,2,3-triamine |
| SMILES | CC(C)c1ccc(N)c(N)c1N |
| InChI | InChI=1S/C9H15N3/c1-5(2)6-3-4-7(10)9(12)8(6)11/h3-5H,10-12H2,1-2H3 |
| InChIKey | UHCADUMXKHLJCV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-propan-2-ylbenzene-1,2,3-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-ylbenzene-1,2,3-triamine?
The IUPAC name of 4-propan-2-ylbenzene-1,2,3-triamine (CID 163998803) is 4-propan-2-ylbenzene-1,2,3-triamine.
What is the SMILES notation for 4-propan-2-ylbenzene-1,2,3-triamine?
The canonical SMILES for 4-propan-2-ylbenzene-1,2,3-triamine is CC(C)c1ccc(N)c(N)c1N.
What is the InChIKey of 4-propan-2-ylbenzene-1,2,3-triamine?
The InChIKey is UHCADUMXKHLJCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3/c1-5(2)6-3-4-7(10)9(12)8(6)11/h3-5H,10-12H2,1-2H3.
What are the key properties of 4-propan-2-ylbenzene-1,2,3-triamine?
4-propan-2-ylbenzene-1,2,3-triamine has a molecular weight of 165.24 g/mol, XLogP of 1.56, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-ylbenzene-1,2,3-triamine is sourced from PubChem (CID 163998803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).