About (2S,3R)-methyl 3-methyl-2-(4-methylpiperidine-1-carboxamido)pentanoate
(2S,3R)-methyl 3-methyl-2-(4-methylpiperidine-1-carboxamido)pentanoate (PubChem CID 16405217) has the molecular formula C14H26N2O3
and a molecular weight of 270.37 g/mol. Its IUPAC name is methyl (2S)-3-methyl-2-[(4-methylpiperidine-1-carbonyl)amino]pentanoate.
Molecular Properties
| Compound Name | (2S,3R)-methyl 3-methyl-2-(4-methylpiperidine-1-carboxamido)pentanoate |
| PubChem CID | 16405217 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | methyl (2S)-3-methyl-2-[(4-methylpiperidine-1-carbonyl)amino]pentanoate |
| SMILES | CCC(C)[C@@H](C(=O)OC)NC(=O)N1CCC(CC1)C |
| InChI | InChI=1S/C14H26N2O3/c1-5-11(3)12(13(17)19-4)15-14(18)16-8-6-10(2)7-9-16/h10-12H,5-9H2,1-4H3,(H,15,18)/t11?,12-/m0/s1 |
| InChIKey | VMIPSTCBMXIGQX-KIYNQFGBSA-N |
| XLogP | 2.50 |
| TPSA | 58.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | 312 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,3R)-methyl 3-methyl-2-(4-methylpiperidine-1-carboxamido)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-methyl 3-methyl-2-(4-methylpiperidine-1-carboxamido)pentanoate?
The IUPAC name of (2S,3R)-methyl 3-methyl-2-(4-methylpiperidine-1-carboxamido)pentanoate (CID 16405217) is methyl (2S)-3-methyl-2-[(4-methylpiperidine-1-carbonyl)amino]pentanoate.
What is the SMILES notation for (2S,3R)-methyl 3-methyl-2-(4-methylpiperidine-1-carboxamido)pentanoate?
The canonical SMILES for (2S,3R)-methyl 3-methyl-2-(4-methylpiperidine-1-carboxamido)pentanoate is CCC(C)[C@@H](C(=O)OC)NC(=O)N1CCC(CC1)C.
What is the InChIKey of (2S,3R)-methyl 3-methyl-2-(4-methylpiperidine-1-carboxamido)pentanoate?
The InChIKey is VMIPSTCBMXIGQX-KIYNQFGBSA-N. The full InChI is InChI=1S/C14H26N2O3/c1-5-11(3)12(13(17)19-4)15-14(18)16-8-6-10(2)7-9-16/h10-12H,5-9H2,1-4H3,(H,15,18)/t11?,12-/m0/s1.
What are the key properties of (2S,3R)-methyl 3-methyl-2-(4-methylpiperidine-1-carboxamido)pentanoate?
(2S,3R)-methyl 3-methyl-2-(4-methylpiperidine-1-carboxamido)pentanoate has a molecular weight of 270.37 g/mol, XLogP of 2.50, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-methyl 3-methyl-2-(4-methylpiperidine-1-carboxamido)pentanoate is sourced from PubChem (CID 16405217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).