C13H13N3O — CID 16413661
2-[(Tetrahydro-2-furanylmethyl)amino]isophthalonitrile (PubChem CID 16413661) has the molecular formula C13H13N3O and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-(oxolan-2-ylmethylamino)benzene-1,3-dicarbonitrile.
| Compound Name | 2-[(Tetrahydro-2-furanylmethyl)amino]isophthalonitrile |
|---|---|
| PubChem CID | 16413661 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2-(oxolan-2-ylmethylamino)benzene-1,3-dicarbonitrile |
| SMILES | C1CC(OC1)CNC2=C(C=CC=C2C#N)C#N |
| InChI | InChI=1S/C13H13N3O/c14-7-10-3-1-4-11(8-15)13(10)16-9-12-5-2-6-17-12/h1,3-4,12,16H,2,5-6,9H2 |
| InChIKey | IWXNOWWKLQQBTR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | 326 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |