C37H61NO8 — CID 164500201
2-[3-nonanoyloxy-2-[(3Z,6Z,9Z,12Z,15Z)-octadeca-3,6,9,12,15-pentaenoyl]oxypropoxy]-2-[2-(trimethylazaniumyl)ethoxy]acetate (PubChem CID 164500201) has the molecular formula C37H61NO8 and a molecular weight of 647.89 g/mol. Its IUPAC name is 2-[3-nonanoyloxy-2-[(3Z,6Z,9Z,12Z,15Z)-octadeca-3,6,9,12,15-pentaenoyl]oxypropoxy]-2-[2-(trimethylazaniumyl)ethoxy]acetate.
| Compound Name | 2-[3-nonanoyloxy-2-[(3Z,6Z,9Z,12Z,15Z)-octadeca-3,6,9,12,15-pentaenoyl]oxypropoxy]-2-[2-(trimethylazaniumyl)ethoxy]acetate |
|---|---|
| PubChem CID | 164500201 |
| Molecular Formula | C37H61NO8 |
| Molecular Weight | 647.89 g/mol |
| Exact Mass | 647.44 |
| IUPAC Name | 2-[3-nonanoyloxy-2-[(3Z,6Z,9Z,12Z,15Z)-octadeca-3,6,9,12,15-pentaenoyl]oxypropoxy]-2-[2-(trimethylazaniumyl)ethoxy]acetate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC(=O)OC(COC(=O)CCCCCCCC)COC(OCC[N+](C)(C)C)C(=O)[O-] |
| InChI | InChI=1S/C37H61NO8/c1-6-8-10-12-14-15-16-17-18-19-20-21-22-24-26-28-35(40)46-33(31-44-34(39)27-25-23-13-11-9-7-2)32-45-37(36(41)42)43-30-29-38(3,4)5/h8,10,14-15,17-18,20-21,24,26,33,37H,6-7,9,11-13,16,19,22-23,25,27-32H2,1-5H3/b10-8-,15-14-,18-17-,21-20-,26-24- |
| InChIKey | ZFTRNYMFUOWLOY-KQCXCOIKSA-N |
| XLogP | 6.15 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.89 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|