C36H61NO3 — CID 164503239
(7Z,10Z,13Z,16Z,19Z)-N-[(E)-1,3-dihydroxytetradec-4-en-2-yl]docosa-7,10,13,16,19-pentaenamide (PubChem CID 164503239) has the molecular formula C36H61NO3 and a molecular weight of 555.89 g/mol. Its IUPAC name is (7Z,10Z,13Z,16Z,19Z)-N-[(E)-1,3-dihydroxytetradec-4-en-2-yl]docosa-7,10,13,16,19-pentaenamide.
| Compound Name | (7Z,10Z,13Z,16Z,19Z)-N-[(E)-1,3-dihydroxytetradec-4-en-2-yl]docosa-7,10,13,16,19-pentaenamide |
|---|---|
| PubChem CID | 164503239 |
| Molecular Formula | C36H61NO3 |
| Molecular Weight | 555.89 g/mol |
| Exact Mass | 555.47 |
| IUPAC Name | (7Z,10Z,13Z,16Z,19Z)-N-[(E)-1,3-dihydroxytetradec-4-en-2-yl]docosa-7,10,13,16,19-pentaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(=O)NC(CO)C(O)/C=C/CCCCCCCCC |
| InChI | InChI=1S/C36H61NO3/c1-3-5-7-9-11-13-14-15-16-17-18-19-20-21-22-24-26-28-30-32-36(40)37-34(33-38)35(39)31-29-27-25-23-12-10-8-6-4-2/h5,7,11,13,15-16,18-19,21-22,29,31,34-35,38-39H,3-4,6,8-10,12,14,17,20,23-28,30,32-33H2,1-2H3,(H,37,40)/b7-5-,13-11-,16-15-,19-18-,22-21-,31-29+ |
| InChIKey | ZLRHIEAAHGXMJN-DBUBSJGUSA-N |
| XLogP | 9.22 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.89 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|