C57H98O5 — CID 164503414
[2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoxy]propyl] (Z)-icos-11-enoate (PubChem CID 164503414) has the molecular formula C57H98O5 and a molecular weight of 863.41 g/mol. Its IUPAC name is [2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoxy]propyl] (Z)-icos-11-enoate.
| Compound Name | [2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoxy]propyl] (Z)-icos-11-enoate |
|---|---|
| PubChem CID | 164503414 |
| Molecular Formula | C57H98O5 |
| Molecular Weight | 863.41 g/mol |
| Exact Mass | 862.74 |
| IUPAC Name | [2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoxy]propyl] (Z)-icos-11-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCOCC(COC(=O)CCCCCCCCC/C=C\CCCCCCCC)OC(=O)CCCCC/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C57H98O5/c1-4-7-10-13-16-19-22-25-27-29-30-33-35-38-41-44-47-50-56(58)61-54-55(62-57(59)51-48-45-42-39-36-32-24-21-18-15-12-9-6-3)53-60-52-49-46-43-40-37-34-31-28-26-23-20-17-14-11-8-5-2/h8-9,11-12,17-18,20-21,25-28,32,36,55H,4-7,10,13-16,19,22-24,29-31,33-35,37-54H2,1-3H3/b11-8-,12-9-,20-17-,21-18-,27-25-,28-26-,36-32- |
| InChIKey | ZMAAXFBUKWFFKI-KTRXBWHNSA-N |
| XLogP | 17.67 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.41 |
| LogP ≤ 5 | 17.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|