C41H68O9 — CID 164505221
[1-[(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoxy]-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] octanoate (PubChem CID 164505221) has the molecular formula C41H68O9 and a molecular weight of 704.99 g/mol. Its IUPAC name is [1-[(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoxy]-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] octanoate.
| Compound Name | [1-[(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoxy]-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] octanoate |
|---|---|
| PubChem CID | 164505221 |
| Molecular Formula | C41H68O9 |
| Molecular Weight | 704.99 g/mol |
| Exact Mass | 704.49 |
| IUPAC Name | [1-[(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoxy]-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] octanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCOCC(COC1OC(CO)C(O)C(O)C1O)OC(=O)CCCCCCC |
| InChI | InChI=1S/C41H68O9/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-27-29-31-47-33-35(49-37(43)30-28-26-8-6-4-2)34-48-41-40(46)39(45)38(44)36(32-42)50-41/h5,7,10-11,13-14,16-17,19-20,22-23,35-36,38-42,44-46H,3-4,6,8-9,12,15,18,21,24-34H2,1-2H3/b7-5-,11-10-,14-13-,17-16-,20-19-,23-22- |
| InChIKey | ZPOHTLOTZWZILR-CWBKFRHXSA-N |
| XLogP | 7.35 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.99 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|