C51H90O5 — CID 164507094
[2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-[(Z)-tetradec-9-enoxy]propyl] (Z)-octadec-9-enoate (PubChem CID 164507094) has the molecular formula C51H90O5 and a molecular weight of 783.28 g/mol. Its IUPAC name is [2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-[(Z)-tetradec-9-enoxy]propyl] (Z)-octadec-9-enoate.
| Compound Name | [2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-[(Z)-tetradec-9-enoxy]propyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 164507094 |
| Molecular Formula | C51H90O5 |
| Molecular Weight | 783.28 g/mol |
| Exact Mass | 782.68 |
| IUPAC Name | [2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-[(Z)-tetradec-9-enoxy]propyl] (Z)-octadec-9-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCC(=O)OC(COCCCCCCCC/C=C\CCCC)COC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C51H90O5/c1-4-7-10-13-16-19-22-25-26-28-29-32-35-38-41-44-50(52)55-48-49(47-54-46-43-40-37-34-31-24-21-18-15-12-9-6-3)56-51(53)45-42-39-36-33-30-27-23-20-17-14-11-8-5-2/h8,11,15,17-18,20,25-27,30,49H,4-7,9-10,12-14,16,19,21-24,28-29,31-48H2,1-3H3/b11-8-,18-15-,20-17-,26-25-,30-27- |
| InChIKey | ZTGBRRAEZNTWAH-JSLXHHBSSA-N |
| XLogP | 15.78 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.28 |
| LogP ≤ 5 | 15.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|