C37H68NO8+ — CID 164507718
2-[carboxy-[2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-undecanoyloxypropoxy]methoxy]ethyl-trimethylazanium (PubChem CID 164507718) has the molecular formula C37H68NO8+ and a molecular weight of 654.95 g/mol. Its IUPAC name is 2-[carboxy-[2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-undecanoyloxypropoxy]methoxy]ethyl-trimethylazanium.
| Compound Name | 2-[carboxy-[2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-undecanoyloxypropoxy]methoxy]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 164507718 |
| Molecular Formula | C37H68NO8+ |
| Molecular Weight | 654.95 g/mol |
| Exact Mass | 654.49 |
| IUPAC Name | 2-[carboxy-[2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-undecanoyloxypropoxy]methoxy]ethyl-trimethylazanium |
| SMILES | CCC/C=C\C/C=C\CCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC)COC(OCC[N+](C)(C)C)C(=O)O |
| InChI | InChI=1S/C37H67NO8/c1-6-8-10-12-14-16-17-18-19-20-22-24-26-28-35(40)46-33(32-45-37(36(41)42)43-30-29-38(3,4)5)31-44-34(39)27-25-23-21-15-13-11-9-7-2/h10,12,16-17,33,37H,6-9,11,13-15,18-32H2,1-5H3/p+1/b12-10-,17-16- |
| InChIKey | ZUNAQQVUEVGHGU-IFVCHSSZSA-O |
| XLogP | 8.16 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.95 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|