C50H86NO8+ — CID 164509553
2-[carboxy-[3-[(Z)-hexadec-9-enoyl]oxy-2-[(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoyl]oxypropoxy]methoxy]ethyl-trimethylazanium (PubChem CID 164509553) has the molecular formula C50H86NO8+ and a molecular weight of 829.24 g/mol. Its IUPAC name is 2-[carboxy-[3-[(Z)-hexadec-9-enoyl]oxy-2-[(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoyl]oxypropoxy]methoxy]ethyl-trimethylazanium.
| Compound Name | 2-[carboxy-[3-[(Z)-hexadec-9-enoyl]oxy-2-[(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoyl]oxypropoxy]methoxy]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 164509553 |
| Molecular Formula | C50H86NO8+ |
| Molecular Weight | 829.24 g/mol |
| Exact Mass | 828.63 |
| IUPAC Name | 2-[carboxy-[3-[(Z)-hexadec-9-enoyl]oxy-2-[(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoyl]oxypropoxy]methoxy]ethyl-trimethylazanium |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC(COC(=O)CCCCCCC/C=C\CCCCCC)COC(OCC[N+](C)(C)C)C(=O)O |
| InChI | InChI=1S/C50H85NO8/c1-6-8-10-12-14-16-18-20-21-22-23-24-25-26-27-29-31-33-35-37-39-41-48(53)59-46(45-58-50(49(54)55)56-43-42-51(3,4)5)44-57-47(52)40-38-36-34-32-30-28-19-17-15-13-11-9-7-2/h8,10,14,16-17,19-21,23-24,26-27,46,50H,6-7,9,11-13,15,18,22,25,28-45H2,1-5H3/p+1/b10-8-,16-14-,19-17-,21-20-,24-23-,27-26- |
| InChIKey | ZXZJKGVUXMURKE-PHMZLQAKSA-O |
| XLogP | 12.33 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.24 |
| LogP ≤ 5 | 12.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|