About 2-(4-fluorophenyl)-2,3-dihydro-1H-imidazo[1,2-b]pyrazole
2-(4-fluorophenyl)-2,3-dihydro-1H-imidazo[1,2-b]pyrazole (PubChem CID 164510757) has the molecular formula C11H10FN3
and a molecular weight of 203.22 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-2,3-dihydro-1H-imidazo[1,2-b]pyrazole.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)-2,3-dihydro-1H-imidazo[1,2-b]pyrazole |
| PubChem CID | 164510757 |
| Molecular Formula | C11H10FN3 |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 2-(4-fluorophenyl)-2,3-dihydro-1H-imidazo[1,2-b]pyrazole |
| SMILES | Fc1ccc(C2Cn3nccc3N2)cc1 |
| InChI | InChI=1S/C11H10FN3/c12-9-3-1-8(2-4-9)10-7-15-11(14-10)5-6-13-15/h1-6,10,14H,7H2 |
| InChIKey | BGARQWGVGXGULJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-fluorophenyl)-2,3-dihydro-1H-imidazo[1,2-b]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)-2,3-dihydro-1H-imidazo[1,2-b]pyrazole?
The IUPAC name of 2-(4-fluorophenyl)-2,3-dihydro-1H-imidazo[1,2-b]pyrazole (CID 164510757) is 2-(4-fluorophenyl)-2,3-dihydro-1H-imidazo[1,2-b]pyrazole.
What is the SMILES notation for 2-(4-fluorophenyl)-2,3-dihydro-1H-imidazo[1,2-b]pyrazole?
The canonical SMILES for 2-(4-fluorophenyl)-2,3-dihydro-1H-imidazo[1,2-b]pyrazole is Fc1ccc(C2Cn3nccc3N2)cc1.
What is the InChIKey of 2-(4-fluorophenyl)-2,3-dihydro-1H-imidazo[1,2-b]pyrazole?
The InChIKey is BGARQWGVGXGULJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FN3/c12-9-3-1-8(2-4-9)10-7-15-11(14-10)5-6-13-15/h1-6,10,14H,7H2.
What are the key properties of 2-(4-fluorophenyl)-2,3-dihydro-1H-imidazo[1,2-b]pyrazole?
2-(4-fluorophenyl)-2,3-dihydro-1H-imidazo[1,2-b]pyrazole has a molecular weight of 203.22 g/mol, XLogP of 2.19, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)-2,3-dihydro-1H-imidazo[1,2-b]pyrazole is sourced from PubChem (CID 164510757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).