C22H37BO2 — CID 164510807
2-[3-(1-adamantyl)-1-bicyclo[1.1.1]pentanyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;methane (PubChem CID 164510807) has the molecular formula C22H37BO2 and a molecular weight of 344.35 g/mol. Its IUPAC name is 2-[3-(1-adamantyl)-1-bicyclo[1.1.1]pentanyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;methane.
| Compound Name | 2-[3-(1-adamantyl)-1-bicyclo[1.1.1]pentanyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;methane |
|---|---|
| PubChem CID | 164510807 |
| Molecular Formula | C22H37BO2 |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.29 |
| IUPAC Name | 2-[3-(1-adamantyl)-1-bicyclo[1.1.1]pentanyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;methane |
| SMILES | C.CC1(C)OB(C23CC(C45CC6CC(CC(C6)C4)C5)(C2)C3)OC1(C)C |
| InChI | InChI=1S/C21H33BO2.CH4/c1-17(2)18(3,4)24-22(23-17)21-11-20(12-21,13-21)19-8-14-5-15(9-19)7-16(6-14)10-19;/h14-16H,5-13H2,1-4H3;1H4 |
| InChIKey | IAZUKBKPKAKRMT-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|