About (3Z)-1-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-(1-methylpyrrolidin-2-ylidene)urea
(3Z)-1-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-(1-methylpyrrolidin-2-ylidene)urea (PubChem CID 164511451) has the molecular formula C14H15Cl2N3O
and a molecular weight of 312.20 g/mol. Its IUPAC name is (3Z)-1-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-(1-methylpyrrolidin-2-ylidene)urea.
Molecular Properties
| Compound Name | (3Z)-1-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-(1-methylpyrrolidin-2-ylidene)urea |
| PubChem CID | 164511451 |
| Molecular Formula | C14H15Cl2N3O |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | (3Z)-1-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-(1-methylpyrrolidin-2-ylidene)urea |
| SMILES | CN1CCC/C1=N/C(=O)N/C=C/c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H15Cl2N3O/c1-19-9-3-6-13(19)18-14(20)17-8-7-10-11(15)4-2-5-12(10)16/h2,4-5,7-8H,3,6,9H2,1H3,(H,17,20)/b8-7+,18-13- |
| InChIKey | KGOJRGILJVNVJC-JZYRRUABSA-N |
| XLogP | 3.80 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-1-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-(1-methylpyrrolidin-2-ylidene)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-1-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-(1-methylpyrrolidin-2-ylidene)urea?
The IUPAC name of (3Z)-1-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-(1-methylpyrrolidin-2-ylidene)urea (CID 164511451) is (3Z)-1-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-(1-methylpyrrolidin-2-ylidene)urea.
What is the SMILES notation for (3Z)-1-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-(1-methylpyrrolidin-2-ylidene)urea?
The canonical SMILES for (3Z)-1-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-(1-methylpyrrolidin-2-ylidene)urea is CN1CCC/C1=N/C(=O)N/C=C/c1c(Cl)cccc1Cl.
What is the InChIKey of (3Z)-1-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-(1-methylpyrrolidin-2-ylidene)urea?
The InChIKey is KGOJRGILJVNVJC-JZYRRUABSA-N. The full InChI is InChI=1S/C14H15Cl2N3O/c1-19-9-3-6-13(19)18-14(20)17-8-7-10-11(15)4-2-5-12(10)16/h2,4-5,7-8H,3,6,9H2,1H3,(H,17,20)/b8-7+,18-13-.
What are the key properties of (3Z)-1-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-(1-methylpyrrolidin-2-ylidene)urea?
(3Z)-1-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-(1-methylpyrrolidin-2-ylidene)urea has a molecular weight of 312.20 g/mol, XLogP of 3.80, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-1-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-(1-methylpyrrolidin-2-ylidene)urea is sourced from PubChem (CID 164511451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).