3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium chloride

C6H13ClN2 — CID 164511525

IUPAC3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium chloride
SMILESCCN1C=C[NH+](C)C1.[Cl-]
InChIInChI=1S/C6H12N2.ClH/c1-3-8-5-4-7(2)6-8;/h4-5H,3,6H2,1-2H3;1H
InChIKeyFQERWQCDIIMLHB-UHFFFAOYSA-N
MW148.64 g/mol
LogP-3.73
Rot. Bonds1

About 3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium chloride

3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium chloride (PubChem CID 164511525) has the molecular formula C6H13ClN2 and a molecular weight of 148.64 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium chloride.

Molecular Properties

Compound Name3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium chloride
PubChem CID164511525
Molecular FormulaC6H13ClN2
Molecular Weight148.64 g/mol
Exact Mass148.08
IUPAC Name3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium chloride
SMILESCCN1C=C[NH+](C)C1.[Cl-]
InChIInChI=1S/C6H12N2.ClH/c1-3-8-5-4-7(2)6-8;/h4-5H,3,6H2,1-2H3;1H
InChIKeyFQERWQCDIIMLHB-UHFFFAOYSA-N
XLogP-3.73
TPSA7.68 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500148.64
LogP ≤ 5-3.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium chloride?
The IUPAC name of 3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium chloride (CID 164511525) is 3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium chloride.
What is the SMILES notation for 3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium chloride?
The canonical SMILES for 3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium chloride is CCN1C=C[NH+](C)C1.[Cl-].
What is the InChIKey of 3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium chloride?
The InChIKey is FQERWQCDIIMLHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2.ClH/c1-3-8-5-4-7(2)6-8;/h4-5H,3,6H2,1-2H3;1H.
What are the key properties of 3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium chloride?
3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium chloride has a molecular weight of 148.64 g/mol, XLogP of -3.73, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium chloride is sourced from PubChem (CID 164511525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).