C14H13N7OS — CID 164513209
9-[[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]methyl]purine-2,6-diamine (PubChem CID 164513209) has the molecular formula C14H13N7OS and a molecular weight of 327.37 g/mol. Its IUPAC name is 9-[[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]methyl]purine-2,6-diamine.
| Compound Name | 9-[[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]methyl]purine-2,6-diamine |
|---|---|
| PubChem CID | 164513209 |
| Molecular Formula | C14H13N7OS |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 9-[[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]methyl]purine-2,6-diamine |
| SMILES | Cc1ccc(-c2nc(Cn3cnc4c(N)nc(N)nc43)cs2)o1 |
| InChI | InChI=1S/C14H13N7OS/c1-7-2-3-9(22-7)13-18-8(5-23-13)4-21-6-17-10-11(15)19-14(16)20-12(10)21/h2-3,5-6H,4H2,1H3,(H4,15,16,19,20) |
| InChIKey | RYLGZXYODNRSDR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 121.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |