About 9-[(2-methyl-1,3-thiazol-4-yl)methyl]purine-2,6-diamine
9-[(2-methyl-1,3-thiazol-4-yl)methyl]purine-2,6-diamine (PubChem CID 164513222) has the molecular formula C10H11N7S
and a molecular weight of 261.31 g/mol. Its IUPAC name is 9-[(2-methyl-1,3-thiazol-4-yl)methyl]purine-2,6-diamine.
Molecular Properties
| Compound Name | 9-[(2-methyl-1,3-thiazol-4-yl)methyl]purine-2,6-diamine |
| PubChem CID | 164513222 |
| Molecular Formula | C10H11N7S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 9-[(2-methyl-1,3-thiazol-4-yl)methyl]purine-2,6-diamine |
| SMILES | Cc1nc(Cn2cnc3c(N)nc(N)nc32)cs1 |
| InChI | InChI=1S/C10H11N7S/c1-5-14-6(3-18-5)2-17-4-13-7-8(11)15-10(12)16-9(7)17/h3-4H,2H2,1H3,(H4,11,12,15,16) |
| InChIKey | INTFUQJSFGYBOV-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 108.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 9-[(2-methyl-1,3-thiazol-4-yl)methyl]purine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(2-methyl-1,3-thiazol-4-yl)methyl]purine-2,6-diamine?
The IUPAC name of 9-[(2-methyl-1,3-thiazol-4-yl)methyl]purine-2,6-diamine (CID 164513222) is 9-[(2-methyl-1,3-thiazol-4-yl)methyl]purine-2,6-diamine.
What is the SMILES notation for 9-[(2-methyl-1,3-thiazol-4-yl)methyl]purine-2,6-diamine?
The canonical SMILES for 9-[(2-methyl-1,3-thiazol-4-yl)methyl]purine-2,6-diamine is Cc1nc(Cn2cnc3c(N)nc(N)nc32)cs1.
What is the InChIKey of 9-[(2-methyl-1,3-thiazol-4-yl)methyl]purine-2,6-diamine?
The InChIKey is INTFUQJSFGYBOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N7S/c1-5-14-6(3-18-5)2-17-4-13-7-8(11)15-10(12)16-9(7)17/h3-4H,2H2,1H3,(H4,11,12,15,16).
What are the key properties of 9-[(2-methyl-1,3-thiazol-4-yl)methyl]purine-2,6-diamine?
9-[(2-methyl-1,3-thiazol-4-yl)methyl]purine-2,6-diamine has a molecular weight of 261.31 g/mol, XLogP of 0.80, 2 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(2-methyl-1,3-thiazol-4-yl)methyl]purine-2,6-diamine is sourced from PubChem (CID 164513222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).