About 6-[3-(4,4-difluoropiperidin-1-yl)propyl]-4-methylpyridin-2-amine
6-[3-(4,4-difluoropiperidin-1-yl)propyl]-4-methylpyridin-2-amine (PubChem CID 164513490) has the molecular formula C14H21F2N3
and a molecular weight of 269.34 g/mol. Its IUPAC name is 6-[3-(4,4-difluoropiperidin-1-yl)propyl]-4-methylpyridin-2-amine.
Molecular Properties
| Compound Name | 6-[3-(4,4-difluoropiperidin-1-yl)propyl]-4-methylpyridin-2-amine |
| PubChem CID | 164513490 |
| Molecular Formula | C14H21F2N3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 6-[3-(4,4-difluoropiperidin-1-yl)propyl]-4-methylpyridin-2-amine |
| SMILES | Cc1cc(N)nc(CCCN2CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C14H21F2N3/c1-11-9-12(18-13(17)10-11)3-2-6-19-7-4-14(15,16)5-8-19/h9-10H,2-8H2,1H3,(H2,17,18) |
| InChIKey | QUDAAAGCJFIIKZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[3-(4,4-difluoropiperidin-1-yl)propyl]-4-methylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(4,4-difluoropiperidin-1-yl)propyl]-4-methylpyridin-2-amine?
The IUPAC name of 6-[3-(4,4-difluoropiperidin-1-yl)propyl]-4-methylpyridin-2-amine (CID 164513490) is 6-[3-(4,4-difluoropiperidin-1-yl)propyl]-4-methylpyridin-2-amine.
What is the SMILES notation for 6-[3-(4,4-difluoropiperidin-1-yl)propyl]-4-methylpyridin-2-amine?
The canonical SMILES for 6-[3-(4,4-difluoropiperidin-1-yl)propyl]-4-methylpyridin-2-amine is Cc1cc(N)nc(CCCN2CCC(F)(F)CC2)c1.
What is the InChIKey of 6-[3-(4,4-difluoropiperidin-1-yl)propyl]-4-methylpyridin-2-amine?
The InChIKey is QUDAAAGCJFIIKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21F2N3/c1-11-9-12(18-13(17)10-11)3-2-6-19-7-4-14(15,16)5-8-19/h9-10H,2-8H2,1H3,(H2,17,18).
What are the key properties of 6-[3-(4,4-difluoropiperidin-1-yl)propyl]-4-methylpyridin-2-amine?
6-[3-(4,4-difluoropiperidin-1-yl)propyl]-4-methylpyridin-2-amine has a molecular weight of 269.34 g/mol, XLogP of 2.64, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(4,4-difluoropiperidin-1-yl)propyl]-4-methylpyridin-2-amine is sourced from PubChem (CID 164513490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).