C25H25F3N4O4 — CID 164514265
N-[(1S)-1-cyclopentyl-2-[4-[2-methyl-1-oxido-4-(trifluoromethyl)pyridin-1-ium-3-yl]anilino]-2-oxoethyl]-3-methyl-1,2-oxazole-4-carboxamide (PubChem CID 164514265) has the molecular formula C25H25F3N4O4 and a molecular weight of 502.49 g/mol. Its IUPAC name is N-[(1S)-1-cyclopentyl-2-[4-[2-methyl-1-oxido-4-(trifluoromethyl)pyridin-1-ium-3-yl]anilino]-2-oxoethyl]-3-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[(1S)-1-cyclopentyl-2-[4-[2-methyl-1-oxido-4-(trifluoromethyl)pyridin-1-ium-3-yl]anilino]-2-oxoethyl]-3-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 164514265 |
| Molecular Formula | C25H25F3N4O4 |
| Molecular Weight | 502.49 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | N-[(1S)-1-cyclopentyl-2-[4-[2-methyl-1-oxido-4-(trifluoromethyl)pyridin-1-ium-3-yl]anilino]-2-oxoethyl]-3-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1nocc1C(=O)N[C@H](C(=O)Nc1ccc(-c2c(C(F)(F)F)cc[n+]([O-])c2C)cc1)C1CCCC1 |
| InChI | InChI=1S/C25H25F3N4O4/c1-14-19(13-36-31-14)23(33)30-22(17-5-3-4-6-17)24(34)29-18-9-7-16(8-10-18)21-15(2)32(35)12-11-20(21)25(26,27)28/h7-13,17,22H,3-6H2,1-2H3,(H,29,34)(H,30,33)/t22-/m0/s1 |
| InChIKey | ZLIFCJKEUWLFKR-QFIPXVFZSA-N |
| XLogP | 4.54 |
| TPSA | 111.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|