C27H29FN4O4 — CID 164514271
N-[(1S)-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)anilino]-1-[(1S)-4-fluorocyclohex-3-en-1-yl]-2-oxoethyl]-3-ethyl-1,2-oxazole-4-carboxamide (PubChem CID 164514271) has the molecular formula C27H29FN4O4 and a molecular weight of 492.55 g/mol. Its IUPAC name is N-[(1S)-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)anilino]-1-[(1S)-4-fluorocyclohex-3-en-1-yl]-2-oxoethyl]-3-ethyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[(1S)-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)anilino]-1-[(1S)-4-fluorocyclohex-3-en-1-yl]-2-oxoethyl]-3-ethyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 164514271 |
| Molecular Formula | C27H29FN4O4 |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | N-[(1S)-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)anilino]-1-[(1S)-4-fluorocyclohex-3-en-1-yl]-2-oxoethyl]-3-ethyl-1,2-oxazole-4-carboxamide |
| SMILES | CCc1nocc1C(=O)N[C@H](C(=O)Nc1ccc(-c2c(C)cc[n+]([O-])c2C)cc1)[C@@H]1CC=C(F)CC1 |
| InChI | InChI=1S/C27H29FN4O4/c1-4-23-22(15-36-31-23)26(33)30-25(19-5-9-20(28)10-6-19)27(34)29-21-11-7-18(8-12-21)24-16(2)13-14-32(35)17(24)3/h7-9,11-15,19,25H,4-6,10H2,1-3H3,(H,29,34)(H,30,33)/t19-,25+/m1/s1 |
| InChIKey | MOOZRWAAAYNKHZ-CLOONOSVSA-N |
| XLogP | 4.54 |
| TPSA | 111.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|