C26H27FN4O4 — CID 164514272
N-[(1S)-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)anilino]-1-[(1S)-4-fluorocyclohex-3-en-1-yl]-2-oxoethyl]-3-methyl-1,2-oxazole-4-carboxamide (PubChem CID 164514272) has the molecular formula C26H27FN4O4 and a molecular weight of 478.52 g/mol. Its IUPAC name is N-[(1S)-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)anilino]-1-[(1S)-4-fluorocyclohex-3-en-1-yl]-2-oxoethyl]-3-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[(1S)-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)anilino]-1-[(1S)-4-fluorocyclohex-3-en-1-yl]-2-oxoethyl]-3-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 164514272 |
| Molecular Formula | C26H27FN4O4 |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | N-[(1S)-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)anilino]-1-[(1S)-4-fluorocyclohex-3-en-1-yl]-2-oxoethyl]-3-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1cc[n+]([O-])c(C)c1-c1ccc(NC(=O)[C@@H](NC(=O)c2conc2C)[C@@H]2CC=C(F)CC2)cc1 |
| InChI | InChI=1S/C26H27FN4O4/c1-15-12-13-31(34)17(3)23(15)18-6-10-21(11-7-18)28-26(33)24(19-4-8-20(27)9-5-19)29-25(32)22-14-35-30-16(22)2/h6-8,10-14,19,24H,4-5,9H2,1-3H3,(H,28,33)(H,29,32)/t19-,24+/m1/s1 |
| InChIKey | GGKVFFYNRJZKJM-DVECYGJZSA-N |
| XLogP | 4.29 |
| TPSA | 111.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|