C25H26ClF2N5O3 — CID 164514295
N-[(1S)-2-[4-(4-chloro-2-methyl-1-oxidopyridin-1-ium-3-yl)anilino]-1-(4,4-difluorocyclohexyl)-2-oxoethyl]-2-methylpyrazole-3-carboxamide (PubChem CID 164514295) has the molecular formula C25H26ClF2N5O3 and a molecular weight of 517.96 g/mol. Its IUPAC name is N-[(1S)-2-[4-(4-chloro-2-methyl-1-oxidopyridin-1-ium-3-yl)anilino]-1-(4,4-difluorocyclohexyl)-2-oxoethyl]-2-methylpyrazole-3-carboxamide.
| Compound Name | N-[(1S)-2-[4-(4-chloro-2-methyl-1-oxidopyridin-1-ium-3-yl)anilino]-1-(4,4-difluorocyclohexyl)-2-oxoethyl]-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 164514295 |
| Molecular Formula | C25H26ClF2N5O3 |
| Molecular Weight | 517.96 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | N-[(1S)-2-[4-(4-chloro-2-methyl-1-oxidopyridin-1-ium-3-yl)anilino]-1-(4,4-difluorocyclohexyl)-2-oxoethyl]-2-methylpyrazole-3-carboxamide |
| SMILES | Cc1c(-c2ccc(NC(=O)[C@@H](NC(=O)c3ccnn3C)C3CCC(F)(F)CC3)cc2)c(Cl)cc[n+]1[O-] |
| InChI | InChI=1S/C25H26ClF2N5O3/c1-15-21(19(26)10-14-33(15)36)16-3-5-18(6-4-16)30-24(35)22(17-7-11-25(27,28)12-8-17)31-23(34)20-9-13-29-32(20)2/h3-6,9-10,13-14,17,22H,7-8,11-12H2,1-2H3,(H,30,35)(H,31,34)/t22-/m0/s1 |
| InChIKey | LXBDBVIZXUJISO-QFIPXVFZSA-N |
| XLogP | 4.24 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.96 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|