C26H28F3N5O3 — CID 164514347
N-[(1S)-1-(4,4-difluorocyclohexyl)-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)-3-fluoroanilino]-2-oxoethyl]-2-methylpyrazole-3-carboxamide (PubChem CID 164514347) has the molecular formula C26H28F3N5O3 and a molecular weight of 515.54 g/mol. Its IUPAC name is N-[(1S)-1-(4,4-difluorocyclohexyl)-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)-3-fluoroanilino]-2-oxoethyl]-2-methylpyrazole-3-carboxamide.
| Compound Name | N-[(1S)-1-(4,4-difluorocyclohexyl)-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)-3-fluoroanilino]-2-oxoethyl]-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 164514347 |
| Molecular Formula | C26H28F3N5O3 |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | N-[(1S)-1-(4,4-difluorocyclohexyl)-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)-3-fluoroanilino]-2-oxoethyl]-2-methylpyrazole-3-carboxamide |
| SMILES | Cc1cc[n+]([O-])c(C)c1-c1ccc(NC(=O)[C@@H](NC(=O)c2ccnn2C)C2CCC(F)(F)CC2)cc1F |
| InChI | InChI=1S/C26H28F3N5O3/c1-15-9-13-34(37)16(2)22(15)19-5-4-18(14-20(19)27)31-25(36)23(17-6-10-26(28,29)11-7-17)32-24(35)21-8-12-30-33(21)3/h4-5,8-9,12-14,17,23H,6-7,10-11H2,1-3H3,(H,31,36)(H,32,35)/t23-/m0/s1 |
| InChIKey | MAOTYBWVRLZVTK-QHCPKHFHSA-N |
| XLogP | 4.04 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|