C28H33F2N5O3 — CID 164514387
N-[1-(3,3-difluorocyclohexyl)-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)anilino]-2-oxoethyl]-2-propan-2-ylpyrazole-3-carboxamide (PubChem CID 164514387) has the molecular formula C28H33F2N5O3 and a molecular weight of 525.60 g/mol. Its IUPAC name is N-[1-(3,3-difluorocyclohexyl)-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)anilino]-2-oxoethyl]-2-propan-2-ylpyrazole-3-carboxamide.
| Compound Name | N-[1-(3,3-difluorocyclohexyl)-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)anilino]-2-oxoethyl]-2-propan-2-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 164514387 |
| Molecular Formula | C28H33F2N5O3 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | N-[1-(3,3-difluorocyclohexyl)-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)anilino]-2-oxoethyl]-2-propan-2-ylpyrazole-3-carboxamide |
| SMILES | Cc1cc[n+]([O-])c(C)c1-c1ccc(NC(=O)C(NC(=O)c2ccnn2C(C)C)C2CCCC(F)(F)C2)cc1 |
| InChI | InChI=1S/C28H33F2N5O3/c1-17(2)35-23(11-14-31-35)26(36)33-25(21-6-5-13-28(29,30)16-21)27(37)32-22-9-7-20(8-10-22)24-18(3)12-15-34(38)19(24)4/h7-12,14-15,17,21,25H,5-6,13,16H2,1-4H3,(H,32,37)(H,33,36) |
| InChIKey | ORUNQFAKDJMAGN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|