C26H28F2N4O4 — CID 164514388
N-[(1R)-1-(4,4-difluorocyclohexyl)-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)anilino]-2-oxoethyl]-3-methyl-1,2-oxazole-4-carboxamide (PubChem CID 164514388) has the molecular formula C26H28F2N4O4 and a molecular weight of 498.53 g/mol. Its IUPAC name is N-[(1R)-1-(4,4-difluorocyclohexyl)-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)anilino]-2-oxoethyl]-3-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[(1R)-1-(4,4-difluorocyclohexyl)-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)anilino]-2-oxoethyl]-3-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 164514388 |
| Molecular Formula | C26H28F2N4O4 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | N-[(1R)-1-(4,4-difluorocyclohexyl)-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)anilino]-2-oxoethyl]-3-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1cc[n+]([O-])c(C)c1-c1ccc(NC(=O)[C@H](NC(=O)c2conc2C)C2CCC(F)(F)CC2)cc1 |
| InChI | InChI=1S/C26H28F2N4O4/c1-15-10-13-32(35)17(3)22(15)18-4-6-20(7-5-18)29-25(34)23(19-8-11-26(27,28)12-9-19)30-24(33)21-14-36-31-16(21)2/h4-7,10,13-14,19,23H,8-9,11-12H2,1-3H3,(H,29,34)(H,30,33)/t23-/m1/s1 |
| InChIKey | PPKJRMPXQVHUJE-HSZRJFAPSA-N |
| XLogP | 4.46 |
| TPSA | 111.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|