C22H19FN6O — CID 164514630
6-fluoro-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-2-N-phenylquinazoline-2,5-diamine (PubChem CID 164514630) has the molecular formula C22H19FN6O and a molecular weight of 402.43 g/mol. Its IUPAC name is 6-fluoro-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-2-N-phenylquinazoline-2,5-diamine.
| Compound Name | 6-fluoro-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-2-N-phenylquinazoline-2,5-diamine |
|---|---|
| PubChem CID | 164514630 |
| Molecular Formula | C22H19FN6O |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 6-fluoro-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-2-N-phenylquinazoline-2,5-diamine |
| SMILES | Cc1c(-c2cc3nc(Nc4ccccc4)ncc3c(N)c2F)cnc2c1NCCO2 |
| InChI | InChI=1S/C22H19FN6O/c1-12-15(10-26-21-20(12)25-7-8-30-21)14-9-17-16(19(24)18(14)23)11-27-22(29-17)28-13-5-3-2-4-6-13/h2-6,9-11,25H,7-8,24H2,1H3,(H,27,28,29) |
| InChIKey | QNYJPLLHYQOYLM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|