C25H23FN6O2 — CID 164514684
2-N-(3,4-dihydro-1H-isochromen-7-yl)-6-fluoro-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine (PubChem CID 164514684) has the molecular formula C25H23FN6O2 and a molecular weight of 458.50 g/mol. Its IUPAC name is 2-N-(3,4-dihydro-1H-isochromen-7-yl)-6-fluoro-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine.
| Compound Name | 2-N-(3,4-dihydro-1H-isochromen-7-yl)-6-fluoro-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine |
|---|---|
| PubChem CID | 164514684 |
| Molecular Formula | C25H23FN6O2 |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 2-N-(3,4-dihydro-1H-isochromen-7-yl)-6-fluoro-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine |
| SMILES | Cc1c(-c2cc3nc(Nc4ccc5c(c4)COCC5)ncc3c(N)c2F)cnc2c1NCCO2 |
| InChI | InChI=1S/C25H23FN6O2/c1-13-18(10-29-24-23(13)28-5-7-34-24)17-9-20-19(22(27)21(17)26)11-30-25(32-20)31-16-3-2-14-4-6-33-12-15(14)8-16/h2-3,8-11,28H,4-7,12,27H2,1H3,(H,30,31,32) |
| InChIKey | SQZXUBMVYILADW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|